C12H19N7O5S — CID 133127832
1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(5-aminotetrazol-1-yl)ethanone (PubChem CID 133127832) has the molecular formula C12H19N7O5S and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(5-aminotetrazol-1-yl)ethanone.
| Compound Name | 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(5-aminotetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 133127832 |
| Molecular Formula | C12H19N7O5S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[(4aR,7aS)-4-(2-methoxyacetyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-(5-aminotetrazol-1-yl)ethanone |
| SMILES | COCC(=O)N1CCN(C(=O)Cn2nnnc2N)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C12H19N7O5S/c1-24-5-11(21)18-3-2-17(8-6-25(22,23)7-9(8)18)10(20)4-19-12(13)14-15-16-19/h8-9H,2-7H2,1H3,(H2,13,14,16)/t8-,9+/m1/s1 |
| InChIKey | FAUBUDOWVPKQFN-BDAKNGLRSA-N |
| XLogP | -3.26 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |