C16H26N4O2S — CID 133128030
N-[(3S,4R)-1-(3-methylsulfanylpropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 133128030) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is N-[(3S,4R)-1-(3-methylsulfanylpropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[(3S,4R)-1-(3-methylsulfanylpropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 133128030 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[(3S,4R)-1-(3-methylsulfanylpropyl)-4-propylpyrrolidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCC[C@@H]1CN(CCCSC)C[C@H]1NC(=O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C16H26N4O2S/c1-3-5-12-9-20(6-4-7-23-2)10-14(12)19-16(22)13-8-17-11-18-15(13)21/h8,11-12,14H,3-7,9-10H2,1-2H3,(H,19,22)(H,17,18,21)/t12-,14-/m1/s1 |
| InChIKey | PVQKWMZMFXAWMW-TZMCWYRMSA-N |
| XLogP | 1.35 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|