C18H30N2O — CID 133128203
1-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(1-ethylpiperidin-4-yl)ethanone (PubChem CID 133128203) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(1-ethylpiperidin-4-yl)ethanone.
| Compound Name | 1-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(1-ethylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 133128203 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 1-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(1-ethylpiperidin-4-yl)ethanone |
| SMILES | CCN1CCC(CC(=O)N2C[C@H]3CC(C)=CC[C@H]3C2)CC1 |
| InChI | InChI=1S/C18H30N2O/c1-3-19-8-6-15(7-9-19)11-18(21)20-12-16-5-4-14(2)10-17(16)13-20/h4,15-17H,3,5-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | NZDJXDNHGRHXFH-DLBZAZTESA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|