C20H23ClN4O — CID 133128264
2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-1-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone (PubChem CID 133128264) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is 2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-1-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-1-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 133128264 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[(1R,4S)-2-azabicyclo[2.2.1]heptan-2-yl]-1-[2-(4-chlorophenyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl]ethanone |
| SMILES | O=C(CN1C[C@H]2CC[C@@H]1C2)N1CCc2nc(-c3ccc(Cl)cc3)[nH]c2C1 |
| InChI | InChI=1S/C20H23ClN4O/c21-15-4-2-14(3-5-15)20-22-17-7-8-24(11-18(17)23-20)19(26)12-25-10-13-1-6-16(25)9-13/h2-5,13,16H,1,6-12H2,(H,22,23)/t13-,16+/m0/s1 |
| InChIKey | BCTJUMYUNDDKIJ-XJKSGUPXSA-N |
| XLogP | 3.10 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |