C21H32N2O2 — CID 133129226
(4aR,8aS)-1-[2-(cyclohexen-1-yl)ethyl]-6-(2-cyclopropylacetyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133129226) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (4aR,8aS)-1-[2-(cyclohexen-1-yl)ethyl]-6-(2-cyclopropylacetyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-[2-(cyclohexen-1-yl)ethyl]-6-(2-cyclopropylacetyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133129226 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (4aR,8aS)-1-[2-(cyclohexen-1-yl)ethyl]-6-(2-cyclopropylacetyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(CC1CC1)N1CC[C@H]2[C@H](CCC(=O)N2CCC2=CCCCC2)C1 |
| InChI | InChI=1S/C21H32N2O2/c24-20-9-8-18-15-22(21(25)14-17-6-7-17)12-11-19(18)23(20)13-10-16-4-2-1-3-5-16/h4,17-19H,1-3,5-15H2/t18-,19+/m1/s1 |
| InChIKey | JLYFOZLAVNKOSF-MOPGFXCFSA-N |
| XLogP | 3.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|