C20H29N3O3 — CID 133129324
2-[(1R,5S)-6-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-N,N-dimethylacetamide (PubChem CID 133129324) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-[(1R,5S)-6-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(1R,5S)-6-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133129324 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[(1R,5S)-6-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C[C@H]2CC[C@@H](C1)N(Cc1ccc3c(c1)OCCO3)C2 |
| InChI | InChI=1S/C20H29N3O3/c1-21(2)20(24)14-22-10-16-3-5-17(13-22)23(12-16)11-15-4-6-18-19(9-15)26-8-7-25-18/h4,6,9,16-17H,3,5,7-8,10-14H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | PFEKCNXOTAXAAK-SJORKVTESA-N |
| XLogP | 1.44 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |