C10H11Br2N3O2 — CID 13312951
9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 13312951) has the molecular formula C10H11Br2N3O2 and a molecular weight of 365.03 g/mol. Its IUPAC name is 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 13312951 |
| Molecular Formula | C10H11Br2N3O2 |
| Molecular Weight | 365.03 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC1CCC(Br)(Br)c2ncc(C(N)=O)c(=O)n21 |
| InChI | InChI=1S/C10H11Br2N3O2/c1-5-2-3-10(11,12)9-14-4-6(7(13)16)8(17)15(5)9/h4-5H,2-3H2,1H3,(H2,13,16) |
| InChIKey | TVUJHMQOJIZPLK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.03 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|