C9H9Br3N2O — CID 13312960
3,9,9-tribromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 13312960) has the molecular formula C9H9Br3N2O and a molecular weight of 400.90 g/mol. Its IUPAC name is 3,9,9-tribromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3,9,9-tribromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 13312960 |
| Molecular Formula | C9H9Br3N2O |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 397.83 |
| IUPAC Name | 3,9,9-tribromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1CCC(Br)(Br)c2ncc(Br)c(=O)n21 |
| InChI | InChI=1S/C9H9Br3N2O/c1-5-2-3-9(11,12)8-13-4-6(10)7(15)14(5)8/h4-5H,2-3H2,1H3 |
| InChIKey | SQWSRGTXANWLLI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|