C18H31N3O4S — CID 133130020
1-[(4aR,7aS)-4-[2-(dimethylamino)acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-cyclohexylethanone (PubChem CID 133130020) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[(4aR,7aS)-4-[2-(dimethylamino)acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-cyclohexylethanone.
| Compound Name | 1-[(4aR,7aS)-4-[2-(dimethylamino)acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 133130020 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[(4aR,7aS)-4-[2-(dimethylamino)acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-2-cyclohexylethanone |
| SMILES | CN(C)CC(=O)N1CCN(C(=O)CC2CCCCC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H31N3O4S/c1-19(2)11-18(23)21-9-8-20(15-12-26(24,25)13-16(15)21)17(22)10-14-6-4-3-5-7-14/h14-16H,3-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PPXZBHHXEUICDX-CVEARBPZSA-N |
| XLogP | 0.35 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |