C24H24N2O2 — CID 133130081
1-[(1R,5S)-6-(anthracene-9-carbonyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone (PubChem CID 133130081) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(1R,5S)-6-(anthracene-9-carbonyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone.
| Compound Name | 1-[(1R,5S)-6-(anthracene-9-carbonyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone |
|---|---|
| PubChem CID | 133130081 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[(1R,5S)-6-(anthracene-9-carbonyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CC[C@@H](C1)N(C(=O)c1c3ccccc3cc3ccccc13)C2 |
| InChI | InChI=1S/C24H24N2O2/c1-16(27)25-13-17-10-11-20(15-25)26(14-17)24(28)23-21-8-4-2-6-18(21)12-19-7-3-5-9-22(19)23/h2-9,12,17,20H,10-11,13-15H2,1H3/t17-,20+/m1/s1 |
| InChIKey | YSWVNBFYYUCMPT-XLIONFOSSA-N |
| XLogP | 4.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|