C18H24N4O — CID 133130425
[6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 133130425) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is [6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133130425 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [6-[(3aS,7aR)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CC1=CC[C@H]2CN(c3cncc(C(=O)N4CCCC4)n3)C[C@H]2C1 |
| InChI | InChI=1S/C18H24N4O/c1-13-4-5-14-11-22(12-15(14)8-13)17-10-19-9-16(20-17)18(23)21-6-2-3-7-21/h4,9-10,14-15H,2-3,5-8,11-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | FAFXEWTUDZDUTN-LSDHHAIUSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|