About (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol
(3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol (PubChem CID 133131035) has the molecular formula C18H24FN3O2
and a molecular weight of 333.41 g/mol. Its IUPAC name is (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol.
Molecular Properties
| Compound Name | (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol |
| PubChem CID | 133131035 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol |
| SMILES | CCN(Cc1cc(F)ccc1-n1nc(C)cc1C)[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C18H24FN3O2/c1-4-21(17-10-24-11-18(17)23)9-14-8-15(19)5-6-16(14)22-13(3)7-12(2)20-22/h5-8,17-18,23H,4,9-11H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | KPOLNQHNTZRIAS-QZTJIDSGSA-N |
| XLogP | 2.21 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol?
The IUPAC name of (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol (CID 133131035) is (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol.
What is the SMILES notation for (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol?
The canonical SMILES for (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol is CCN(Cc1cc(F)ccc1-n1nc(C)cc1C)[C@@H]1COC[C@H]1O.
What is the InChIKey of (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol?
The InChIKey is KPOLNQHNTZRIAS-QZTJIDSGSA-N. The full InChI is InChI=1S/C18H24FN3O2/c1-4-21(17-10-24-11-18(17)23)9-14-8-15(19)5-6-16(14)22-13(3)7-12(2)20-22/h5-8,17-18,23H,4,9-11H2,1-3H3/t17-,18-/m1/s1.
What are the key properties of (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol?
(3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol has a molecular weight of 333.41 g/mol, XLogP of 2.21, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4-[[2-(3,5-dimethylpyrazol-1-yl)-5-fluorophenyl]methyl-ethylamino]oxolan-3-ol is sourced from PubChem (CID 133131035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).