C15H25N3O3 — CID 133131299
1-[3-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-3-oxopropyl]pyrrolidin-2-one (PubChem CID 133131299) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[3-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-3-oxopropyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-3-oxopropyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 133131299 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[3-[(4aR,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydro-2,7-naphthyridin-2-yl]-3-oxopropyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCC(=O)N1CC[C@]2(O)CCNC[C@@H]2C1 |
| InChI | InChI=1S/C15H25N3O3/c19-13-2-1-7-17(13)8-3-14(20)18-9-5-15(21)4-6-16-10-12(15)11-18/h12,16,21H,1-11H2/t12-,15-/m1/s1 |
| InChIKey | SIWITDMFYXLZJC-IUODEOHRSA-N |
| XLogP | -0.43 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |