C22H29N3O3 — CID 133131593
N-[(2R,4S,6R)-2-ethyl-6-(2-morpholin-4-ylquinolin-3-yl)oxan-4-yl]acetamide (PubChem CID 133131593) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[(2R,4S,6R)-2-ethyl-6-(2-morpholin-4-ylquinolin-3-yl)oxan-4-yl]acetamide.
| Compound Name | N-[(2R,4S,6R)-2-ethyl-6-(2-morpholin-4-ylquinolin-3-yl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 133131593 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[(2R,4S,6R)-2-ethyl-6-(2-morpholin-4-ylquinolin-3-yl)oxan-4-yl]acetamide |
| SMILES | CC[C@@H]1C[C@H](NC(C)=O)C[C@H](c2cc3ccccc3nc2N2CCOCC2)O1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-18-13-17(23-15(2)26)14-21(28-18)19-12-16-6-4-5-7-20(16)24-22(19)25-8-10-27-11-9-25/h4-7,12,17-18,21H,3,8-11,13-14H2,1-2H3,(H,23,26)/t17-,18+,21+/m0/s1 |
| InChIKey | SUVYKZKAIMIGNS-WAOWUJCRSA-N |
| XLogP | 3.21 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |