C20H26N4O2 — CID 133131739
1-N'-[(3S,4R)-1-[(2-cyanophenyl)methyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 133131739) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-N'-[(3S,4R)-1-[(2-cyanophenyl)methyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3S,4R)-1-[(2-cyanophenyl)methyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 133131739 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-N'-[(3S,4R)-1-[(2-cyanophenyl)methyl]-4-propan-2-ylpyrrolidin-3-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | CC(C)[C@@H]1CN(Cc2ccccc2C#N)C[C@H]1NC(=O)C1(C(N)=O)CC1 |
| InChI | InChI=1S/C20H26N4O2/c1-13(2)16-11-24(10-15-6-4-3-5-14(15)9-21)12-17(16)23-19(26)20(7-8-20)18(22)25/h3-6,13,16-17H,7-8,10-12H2,1-2H3,(H2,22,25)(H,23,26)/t16-,17+/m0/s1 |
| InChIKey | HEASDNPHFXVKSC-DLBZAZTESA-N |
| XLogP | 1.40 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|