C15H17ClF2N2O3S — CID 133132228
(2-chloro-4,5-difluorophenyl)-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone (PubChem CID 133132228) has the molecular formula C15H17ClF2N2O3S and a molecular weight of 378.83 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone |
|---|---|
| PubChem CID | 133132228 |
| Molecular Formula | C15H17ClF2N2O3S |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[(1S,5S)-3-methylsulfonyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]methanone |
| SMILES | CS(=O)(=O)N1C[C@H]2CC[C@@H](C1)N(C(=O)c1cc(F)c(F)cc1Cl)C2 |
| InChI | InChI=1S/C15H17ClF2N2O3S/c1-24(22,23)19-6-9-2-3-10(8-19)20(7-9)15(21)11-4-13(17)14(18)5-12(11)16/h4-5,9-10H,2-3,6-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | OKKZCIRIAZZWQR-ZJUUUORDSA-N |
| XLogP | 2.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|