C21H31N3O2 — CID 133132353
(2S,3S,6S)-N-butyl-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide (PubChem CID 133132353) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is (2S,3S,6S)-N-butyl-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide.
| Compound Name | (2S,3S,6S)-N-butyl-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide |
|---|---|
| PubChem CID | 133132353 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | (2S,3S,6S)-N-butyl-3-(4-methoxyphenyl)-1,5-diazatricyclo[5.2.2.02,6]undecane-5-carboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](c2ccc(OC)cc2)[C@H]2[C@@H]1C1CCN2CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-3-4-11-22-21(25)24-14-18(15-5-7-17(26-2)8-6-15)20-19(24)16-9-12-23(20)13-10-16/h5-8,16,18-20H,3-4,9-14H2,1-2H3,(H,22,25)/t18-,19+,20+/m1/s1 |
| InChIKey | LGKQRARAZYZGRV-AABGKKOBSA-N |
| XLogP | 3.07 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|