C23H29N3O2 — CID 133132692
[(1S,5S)-6-(3-phenylmethoxypropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyridin-2-ylmethanone (PubChem CID 133132692) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is [(1S,5S)-6-(3-phenylmethoxypropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(1S,5S)-6-(3-phenylmethoxypropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 133132692 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | [(1S,5S)-6-(3-phenylmethoxypropyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1C[C@H]2CC[C@@H](C1)N(CCCOCc1ccccc1)C2 |
| InChI | InChI=1S/C23H29N3O2/c27-23(22-9-4-5-12-24-22)26-16-20-10-11-21(17-26)25(15-20)13-6-14-28-18-19-7-2-1-3-8-19/h1-5,7-9,12,20-21H,6,10-11,13-18H2/t20-,21-/m0/s1 |
| InChIKey | DAOUFELBWULUPL-SFTDATJTSA-N |
| XLogP | 3.22 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|