C16H26N6O3S — CID 133132924
1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4-(tetrazol-1-yl)butan-1-one (PubChem CID 133132924) has the molecular formula C16H26N6O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4-(tetrazol-1-yl)butan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4-(tetrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 133132924 |
| Molecular Formula | C16H26N6O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-4-(tetrazol-1-yl)butan-1-one |
| SMILES | CC(C)=CCN1CCN(C(=O)CCCn2cnnn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H26N6O3S/c1-13(2)5-7-20-8-9-22(15-11-26(24,25)10-14(15)20)16(23)4-3-6-21-12-17-18-19-21/h5,12,14-15H,3-4,6-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | WLXJRJBAMSBIHX-LSDHHAIUSA-N |
| XLogP | -0.27 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|