C15H26N4O2S2 — CID 133133343
(4aR,7aS)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-methylsulfanylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133133343) has the molecular formula C15H26N4O2S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (4aR,7aS)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-methylsulfanylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-methylsulfanylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133133343 |
| Molecular Formula | C15H26N4O2S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (4aR,7aS)-4-[(5-methyl-1H-imidazol-4-yl)methyl]-1-(3-methylsulfanylpropyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CSCCCN1CCN(Cc2nc[nH]c2C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H26N4O2S2/c1-12-13(17-11-16-12)8-19-6-5-18(4-3-7-22-2)14-9-23(20,21)10-15(14)19/h11,14-15H,3-10H2,1-2H3,(H,16,17)/t14-,15+/m1/s1 |
| InChIKey | PHQKCEZAHOGMBX-CABCVRRESA-N |
| XLogP | 0.75 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|