C14H23N5O4S2 — CID 133133878
5-[[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]-N-ethylpyrimidin-2-amine (PubChem CID 133133878) has the molecular formula C14H23N5O4S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-[[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]-N-ethylpyrimidin-2-amine.
| Compound Name | 5-[[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 133133878 |
| Molecular Formula | C14H23N5O4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-[[(4aR,7aS)-4-methylsulfonyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(CN2CCN(S(C)(=O)=O)[C@H]3CS(=O)(=O)C[C@H]32)cn1 |
| InChI | InChI=1S/C14H23N5O4S2/c1-3-15-14-16-6-11(7-17-14)8-18-4-5-19(24(2,20)21)13-10-25(22,23)9-12(13)18/h6-7,12-13H,3-5,8-10H2,1-2H3,(H,15,16,17)/t12-,13+/m1/s1 |
| InChIKey | WQQWCGGXEQTLFH-OLZOCXBDSA-N |
| XLogP | -0.85 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |