C20H28N4O3 — CID 133134726
(3aS,6aS)-5-benzyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 133134726) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3aS,6aS)-5-benzyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-5-benzyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 133134726 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (3aS,6aS)-5-benzyl-N-[2-(2-oxo-1,3-oxazinan-3-yl)ethyl]-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | O=C1OCCCN1CCNC(=O)[C@]12CNC[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H28N4O3/c25-18(22-7-9-24-8-4-10-27-19(24)26)20-14-21-11-17(20)13-23(15-20)12-16-5-2-1-3-6-16/h1-3,5-6,17,21H,4,7-15H2,(H,22,25)/t17-,20-/m0/s1 |
| InChIKey | ZUVKEUGISMHNEW-PXNSSMCTSA-N |
| XLogP | 0.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |