C19H21FN2O2S — CID 133134893
(3aR,6aR)-2-[(3-fluorophenyl)methyl]-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133134893) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is (3aR,6aR)-2-[(3-fluorophenyl)methyl]-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-[(3-fluorophenyl)methyl]-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133134893 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3aR,6aR)-2-[(3-fluorophenyl)methyl]-5-(thiophen-2-ylmethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CN(Cc3cccc(F)c3)C[C@@H]1CN(Cc1cccs1)C2 |
| InChI | InChI=1S/C19H21FN2O2S/c20-16-4-1-3-14(7-16)8-21-9-15-10-22(11-17-5-2-6-25-17)13-19(15,12-21)18(23)24/h1-7,15H,8-13H2,(H,23,24)/t15-,19-/m1/s1 |
| InChIKey | UDFWGMCJHQIZPR-DNVCBOLYSA-N |
| XLogP | 2.91 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |