C18H26N4O3S — CID 133135182
[(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone (PubChem CID 133135182) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is [(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone.
| Compound Name | [(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 133135182 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [(4aS,7aR)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)=CCN1CCN(C(=O)c2cc(C3CC3)[nH]n2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H26N4O3S/c1-12(2)5-6-21-7-8-22(17-11-26(24,25)10-16(17)21)18(23)15-9-14(19-20-15)13-3-4-13/h5,9,13,16-17H,3-4,6-8,10-11H2,1-2H3,(H,19,20)/t16-,17+/m0/s1 |
| InChIKey | FKLATZKHTBEZKL-DLBZAZTESA-N |
| XLogP | 1.18 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|