C18H28N4O4S — CID 133135256
1-[(4aR,7aS)-1-[(3-cyclopentylimidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone (PubChem CID 133135256) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-[(3-cyclopentylimidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone.
| Compound Name | 1-[(4aR,7aS)-1-[(3-cyclopentylimidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 133135256 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(4aR,7aS)-1-[(3-cyclopentylimidazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(Cc2cncn2C2CCCC2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H28N4O4S/c1-26-10-18(23)21-7-6-20(16-11-27(24,25)12-17(16)21)9-15-8-19-13-22(15)14-4-2-3-5-14/h8,13-14,16-17H,2-7,9-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | SBNADNKEGBWRGE-SJORKVTESA-N |
| XLogP | 0.45 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |