C16H23N5O2S — CID 133135375
(4aR,7aS)-1-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133135375) has the molecular formula C16H23N5O2S and a molecular weight of 349.46 g/mol. Its IUPAC name is (4aR,7aS)-1-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-1-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133135375 |
| Molecular Formula | C16H23N5O2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (4aR,7aS)-1-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-pyrimidin-2-yl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | O=S1(=O)C[C@@H]2[C@H](C1)N(c1ncccn1)CCN2CC1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C16H23N5O2S/c22-24(23)9-14-15(10-24)21(16-18-2-1-3-19-16)5-4-20(14)8-13-11-6-17-7-12(11)13/h1-3,11-15,17H,4-10H2/t11-,12+,13?,14-,15+/m1/s1 |
| InChIKey | YXJGHMITPKEHAL-WQGXVZNYSA-N |
| XLogP | -0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |