C18H26N6O — CID 133136414
[(2R,3aS,7aR)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 133136414) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is [(2R,3aS,7aR)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(2R,3aS,7aR)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 133136414 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(2R,3aS,7aR)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CC(C)N1[C@@H](Cn2cncn2)C[C@H]2CN(C(=O)c3ccc[nH]3)CC[C@H]21 |
| InChI | InChI=1S/C18H26N6O/c1-13(2)24-15(10-23-12-19-11-21-23)8-14-9-22(7-5-17(14)24)18(25)16-4-3-6-20-16/h3-4,6,11-15,17,20H,5,7-10H2,1-2H3/t14-,15+,17+/m0/s1 |
| InChIKey | NYBHOLNTKHYTNG-ZMSDIMECSA-N |
| XLogP | 1.62 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |