C15H23N3O — CID 133136869
[(3aS,7aS)-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 133136869) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is [(3aS,7aS)-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(3aS,7aS)-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 133136869 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | [(3aS,7aS)-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CC(C)N1CC[C@@H]2CN(C(=O)c3ccc[nH]3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H23N3O/c1-11(2)17-7-5-12-8-18(10-13(12)9-17)15(19)14-4-3-6-16-14/h3-4,6,11-13,16H,5,7-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | ARHFTMXJWZMWDY-OLZOCXBDSA-N |
| XLogP | 1.82 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |