C15H23N5S3 — CID 13313697
3-N-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 13313697) has the molecular formula C15H23N5S3 and a molecular weight of 369.59 g/mol. Its IUPAC name is 3-N-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 13313697 |
| Molecular Formula | C15H23N5S3 |
| Molecular Weight | 369.59 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-N-[2-[[5-(piperidin-1-ylmethyl)thiophen-3-yl]methylsulfanyl]ethyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | Nc1nsnc1NCCSCc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C15H23N5S3/c16-14-15(19-23-18-14)17-4-7-21-10-12-8-13(22-11-12)9-20-5-2-1-3-6-20/h8,11H,1-7,9-10H2,(H2,16,18)(H,17,19) |
| InChIKey | HCBVAPDYYRYBBB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|