C18H27N5O — CID 133136997
(2R,3aS,7aR)-5-(furan-3-ylmethyl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 133136997) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is (2R,3aS,7aR)-5-(furan-3-ylmethyl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2R,3aS,7aR)-5-(furan-3-ylmethyl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 133136997 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2R,3aS,7aR)-5-(furan-3-ylmethyl)-1-propan-2-yl-2-(1,2,4-triazol-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CC(C)N1[C@@H](Cn2cncn2)C[C@H]2CN(Cc3ccoc3)CC[C@H]21 |
| InChI | InChI=1S/C18H27N5O/c1-14(2)23-17(10-22-13-19-12-20-22)7-16-9-21(5-3-18(16)23)8-15-4-6-24-11-15/h4,6,11-14,16-18H,3,5,7-10H2,1-2H3/t16-,17+,18+/m0/s1 |
| InChIKey | JFGLDBLNHOUEDB-RCCFBDPRSA-N |
| XLogP | 2.24 |
| TPSA | 50.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |