About N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide
N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide (PubChem CID 133137059) has the molecular formula C17H24F2N2O3S
and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide |
| PubChem CID | 133137059 |
| Molecular Formula | C17H24F2N2O3S |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCOC2(CCN(Cc3cc(F)ccc3F)CC2)C1 |
| InChI | InChI=1S/C17H24F2N2O3S/c1-25(22,23)20-15-4-9-24-17(11-15)5-7-21(8-6-17)12-13-10-14(18)2-3-16(13)19/h2-3,10,15,20H,4-9,11-12H2,1H3 |
| InChIKey | MGOADHTURBJHAV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide?
The IUPAC name of N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide (CID 133137059) is N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide.
What is the SMILES notation for N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide?
The canonical SMILES for N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide is CS(=O)(=O)NC1CCOC2(CCN(Cc3cc(F)ccc3F)CC2)C1.
What is the InChIKey of N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide?
The InChIKey is MGOADHTURBJHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N2O3S/c1-25(22,23)20-15-4-9-24-17(11-15)5-7-21(8-6-17)12-13-10-14(18)2-3-16(13)19/h2-3,10,15,20H,4-9,11-12H2,1H3.
What are the key properties of N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide?
N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide has a molecular weight of 374.45 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[9-[(2,5-difluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]methanesulfonamide is sourced from PubChem (CID 133137059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).