C19H27FN4O3 — CID 133137444
2-[2-[2-(5-fluoropyrimidin-2-yl)-5-oxa-2-azaspiro[3.5]nonan-8-yl]ethoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 133137444) has the molecular formula C19H27FN4O3 and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[2-[2-(5-fluoropyrimidin-2-yl)-5-oxa-2-azaspiro[3.5]nonan-8-yl]ethoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-5-oxa-2-azaspiro[3.5]nonan-8-yl]ethoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 133137444 |
| Molecular Formula | C19H27FN4O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-[2-[2-(5-fluoropyrimidin-2-yl)-5-oxa-2-azaspiro[3.5]nonan-8-yl]ethoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(COCCC1CCOC2(C1)CN(c1ncc(F)cn1)C2)N1CCCC1 |
| InChI | InChI=1S/C19H27FN4O3/c20-16-10-21-18(22-11-16)24-13-19(14-24)9-15(4-8-27-19)3-7-26-12-17(25)23-5-1-2-6-23/h10-11,15H,1-9,12-14H2 |
| InChIKey | MZUQHOMMNGQMHU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|