C19H32N4O3S — CID 133137756
1-[(4aR,7aS)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one (PubChem CID 133137756) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 133137756 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[(4aR,7aS)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one |
| SMILES | CCCCc1ncc(CN2CCN(C(=O)CC(C)C)[C@H]3CS(=O)(=O)C[C@H]32)[nH]1 |
| InChI | InChI=1S/C19H32N4O3S/c1-4-5-6-18-20-10-15(21-18)11-22-7-8-23(19(24)9-14(2)3)17-13-27(25,26)12-16(17)22/h10,14,16-17H,4-9,11-13H2,1-3H3,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | SGBAYYRXBUHMSC-SJORKVTESA-N |
| XLogP | 1.61 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |