C19H22N2O5 — CID 133138281
(3aS,6aR)-2-(2,3-dihydro-1-benzofuran-5-carbonyl)-6-oxo-5-propyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 133138281) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,3-dihydro-1-benzofuran-5-carbonyl)-6-oxo-5-propyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(2,3-dihydro-1-benzofuran-5-carbonyl)-6-oxo-5-propyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 133138281 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (3aS,6aR)-2-(2,3-dihydro-1-benzofuran-5-carbonyl)-6-oxo-5-propyl-1,3,4,6a-tetrahydropyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCCN1C[C@]2(C(=O)O)CN(C(=O)c3ccc4c(c3)CCO4)C[C@@H]2C1=O |
| InChI | InChI=1S/C19H22N2O5/c1-2-6-20-10-19(18(24)25)11-21(9-14(19)17(20)23)16(22)13-3-4-15-12(8-13)5-7-26-15/h3-4,8,14H,2,5-7,9-11H2,1H3,(H,24,25)/t14-,19+/m1/s1 |
| InChIKey | DDRNTIJYCPLOTC-KUHUBIRLSA-N |
| XLogP | 1.02 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |