C18H25N5O4 — CID 133138981
methyl (1R,3S,3aR,6aS)-1-(2-aminopyrimidin-5-yl)-5-ethyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 133138981) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-1-(2-aminopyrimidin-5-yl)-5-ethyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-1-(2-aminopyrimidin-5-yl)-5-ethyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 133138981 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-1-(2-aminopyrimidin-5-yl)-5-ethyl-3-(2-methylpropyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCN1C(=O)[C@H]2[C@@H](C1=O)[C@@](CC(C)C)(C(=O)OC)N[C@H]2c1cnc(N)nc1 |
| InChI | InChI=1S/C18H25N5O4/c1-5-23-14(24)11-12(15(23)25)18(6-9(2)3,16(26)27-4)22-13(11)10-7-20-17(19)21-8-10/h7-9,11-13,22H,5-6H2,1-4H3,(H2,19,20,21)/t11-,12-,13-,18-/m0/s1 |
| InChIKey | SCULLXSNRGICQN-RSLFNQERSA-N |
| XLogP | 0.28 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|