About [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol
[(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol (PubChem CID 133139041) has the molecular formula C14H21FN4O2
and a molecular weight of 296.35 g/mol. Its IUPAC name is [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol |
| PubChem CID | 133139041 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol |
| SMILES | OC[C@@H]1CN(c2ncc(F)cn2)C[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C14H21FN4O2/c15-13-5-16-14(17-6-13)19-8-11(12(9-19)10-20)7-18-1-3-21-4-2-18/h5-6,11-12,20H,1-4,7-10H2/t11-,12-/m0/s1 |
| InChIKey | ZJQBXJPXXLDPQT-RYUDHWBXSA-N |
| XLogP | -0.01 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol?
The IUPAC name of [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol (CID 133139041) is [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol is OC[C@@H]1CN(c2ncc(F)cn2)C[C@@H]1CN1CCOCC1.
What is the InChIKey of [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol?
The InChIKey is ZJQBXJPXXLDPQT-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H21FN4O2/c15-13-5-16-14(17-6-13)19-8-11(12(9-19)10-20)7-18-1-3-21-4-2-18/h5-6,11-12,20H,1-4,7-10H2/t11-,12-/m0/s1.
What are the key properties of [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol?
[(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol has a molecular weight of 296.35 g/mol, XLogP of -0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-1-(5-fluoropyrimidin-2-yl)-4-(morpholin-4-ylmethyl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 133139041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).