C16H22N4O3 — CID 133139903
N-[(3R,3aR,7aR)-1-(oxolan-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrazine-2-carboxamide (PubChem CID 133139903) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(3R,3aR,7aR)-1-(oxolan-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(3R,3aR,7aR)-1-(oxolan-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133139903 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[(3R,3aR,7aR)-1-(oxolan-3-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]pyrazine-2-carboxamide |
| SMILES | O=C(N[C@@H]1CN(C2CCOC2)[C@@H]2CCCO[C@@H]21)c1cnccn1 |
| InChI | InChI=1S/C16H22N4O3/c21-16(12-8-17-4-5-18-12)19-13-9-20(11-3-7-22-10-11)14-2-1-6-23-15(13)14/h4-5,8,11,13-15H,1-3,6-7,9-10H2,(H,19,21)/t11?,13-,14-,15-/m1/s1 |
| InChIKey | YAOSXJKLYJVNTR-YKYOPCIESA-N |
| XLogP | 0.23 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |