About (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone
(3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone (PubChem CID 133139940) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone.
Molecular Properties
| Compound Name | (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone |
| PubChem CID | 133139940 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone |
| SMILES | CCOc1ccsc1C(=O)N1Cc2ccnn2C(COC)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-3-21-13-5-7-22-14(13)15(19)17-8-11-4-6-16-18(11)12(9-17)10-20-2/h4-7,12H,3,8-10H2,1-2H3 |
| InChIKey | OSKCJCAWZFKTDD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone?
The IUPAC name of (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone (CID 133139940) is (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone.
What is the SMILES notation for (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone?
The canonical SMILES for (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone is CCOc1ccsc1C(=O)N1Cc2ccnn2C(COC)C1.
What is the InChIKey of (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone?
The InChIKey is OSKCJCAWZFKTDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-3-21-13-5-7-22-14(13)15(19)17-8-11-4-6-16-18(11)12(9-17)10-20-2/h4-7,12H,3,8-10H2,1-2H3.
What are the key properties of (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone?
(3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone has a molecular weight of 321.40 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxythiophen-2-yl)-[7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]methanone is sourced from PubChem (CID 133139940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).