C18H27N3O3 — CID 133141614
(3aS,7S,7aS)-2-(2-ethoxyethyl)-N-(2-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 133141614) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3aS,7S,7aS)-2-(2-ethoxyethyl)-N-(2-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aS,7S,7aS)-2-(2-ethoxyethyl)-N-(2-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 133141614 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3aS,7S,7aS)-2-(2-ethoxyethyl)-N-(2-methyl-3-pyridinyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | CCOCCN1C[C@H]2COC[C@@H](C(=O)Nc3cccnc3C)[C@H]2C1 |
| InChI | InChI=1S/C18H27N3O3/c1-3-23-8-7-21-9-14-11-24-12-16(15(14)10-21)18(22)20-17-5-4-6-19-13(17)2/h4-6,14-16H,3,7-12H2,1-2H3,(H,20,22)/t14-,15-,16+/m0/s1 |
| InChIKey | GDLYJFHYEGYXQY-HRCADAONSA-N |
| XLogP | 1.56 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|