About 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea
3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea (PubChem CID 133141859) has the molecular formula C20H27FN4O2
and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea |
| PubChem CID | 133141859 |
| Molecular Formula | C20H27FN4O2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1CCOC2(CCN(Cc3ccc(F)c(C#N)c3)CC2)C1 |
| InChI | InChI=1S/C20H27FN4O2/c1-24(2)19(26)23-17-5-10-27-20(12-17)6-8-25(9-7-20)14-15-3-4-18(21)16(11-15)13-22/h3-4,11,17H,5-10,12,14H2,1-2H3,(H,23,26) |
| InChIKey | LJQPIYJTVDTPTB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea?
The IUPAC name of 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea (CID 133141859) is 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea.
What is the SMILES notation for 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea?
The canonical SMILES for 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea is CN(C)C(=O)NC1CCOC2(CCN(Cc3ccc(F)c(C#N)c3)CC2)C1.
What is the InChIKey of 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea?
The InChIKey is LJQPIYJTVDTPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FN4O2/c1-24(2)19(26)23-17-5-10-27-20(12-17)6-8-25(9-7-20)14-15-3-4-18(21)16(11-15)13-22/h3-4,11,17H,5-10,12,14H2,1-2H3,(H,23,26).
What are the key properties of 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea?
3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea has a molecular weight of 374.46 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[9-[(3-cyano-4-fluorophenyl)methyl]-1-oxa-9-azaspiro[5.5]undecan-4-yl]-1,1-dimethylurea is sourced from PubChem (CID 133141859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).