C14H22N4O3S — CID 133142202
N-[(3R,3aS,7aR)-1-(5-ethylpyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide (PubChem CID 133142202) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[(3R,3aS,7aR)-1-(5-ethylpyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,3aS,7aR)-1-(5-ethylpyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133142202 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(3R,3aS,7aR)-1-(5-ethylpyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
| SMILES | CCc1cnc(N2C[C@@H](NS(C)(=O)=O)[C@H]3OCCC[C@H]32)nc1 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-10-7-15-14(16-8-10)18-9-11(17-22(2,19)20)13-12(18)5-4-6-21-13/h7-8,11-13,17H,3-6,9H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | MUIHJZDEDNVLAM-JHJVBQTASA-N |
| XLogP | 0.32 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |