C12H21N3O4S — CID 133142269
(1R,5R,7S)-N-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide (PubChem CID 133142269) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is (1R,5R,7S)-N-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide.
| Compound Name | (1R,5R,7S)-N-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 133142269 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1R,5R,7S)-N-(2-methylpropyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
| SMILES | CC(C)CNC(=O)N1C[C@@H]2C[C@@H]3[C@](CNS3(=O)=O)(C1)O2 |
| InChI | InChI=1S/C12H21N3O4S/c1-8(2)4-13-11(16)15-5-9-3-10-12(7-15,19-9)6-14-20(10,17)18/h8-10,14H,3-7H2,1-2H3,(H,13,16)/t9-,10+,12-/m0/s1 |
| InChIKey | WYTCGHNHHSMZES-UMNHJUIQSA-N |
| XLogP | -0.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |