About N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide
N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide (PubChem CID 13314232) has the molecular formula C21H26N2O3
and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide |
| PubChem CID | 13314232 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2CCN(Cc3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C21H26N2O3/c1-25-19-10-6-9-18(20(19)26-2)21(24)22-17-11-13-23(14-12-17)15-16-7-4-3-5-8-16/h3-10,17H,11-15H2,1-2H3,(H,22,24) |
| InChIKey | CFOLDWHTVLAWTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide?
The IUPAC name of N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide (CID 13314232) is N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide.
What is the SMILES notation for N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide?
The canonical SMILES for N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide is COc1cccc(C(=O)NC2CCN(Cc3ccccc3)CC2)c1OC.
What is the InChIKey of N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide?
The InChIKey is CFOLDWHTVLAWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3/c1-25-19-10-6-9-18(20(19)26-2)21(24)22-17-11-13-23(14-12-17)15-16-7-4-3-5-8-16/h3-10,17H,11-15H2,1-2H3,(H,22,24).
What are the key properties of N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide?
N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide has a molecular weight of 354.45 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-benzylpiperidin-4-yl)-2,3-dimethoxybenzamide is sourced from PubChem (CID 13314232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).