C14H22N2O2 — CID 133142470
(8aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine (PubChem CID 133142470) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (8aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine.
| Compound Name | (8aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 133142470 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (8aR)-1-[(5-ethylfuran-2-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine |
| SMILES | CCc1ccc(CN2CCOC3CNCC[C@H]32)o1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-11-3-4-12(18-11)10-16-7-8-17-14-9-15-6-5-13(14)16/h3-4,13-15H,2,5-10H2,1H3/t13-,14?/m1/s1 |
| InChIKey | WRHRSDKYNLKSSD-KWCCSABGSA-N |
| XLogP | 1.40 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |