C14H23N3O4S — CID 133142476
(3R,3aR,7aS)-1-methylsulfonyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 133142476) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is (3R,3aR,7aS)-1-methylsulfonyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3R,3aR,7aS)-1-methylsulfonyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 133142476 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3R,3aR,7aS)-1-methylsulfonyl-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | CS(=O)(=O)N1C[C@@H](OCCCn2cccn2)[C@@H]2OCCC[C@@H]21 |
| InChI | InChI=1S/C14H23N3O4S/c1-22(18,19)17-11-13(14-12(17)5-2-9-21-14)20-10-4-8-16-7-3-6-15-16/h3,6-7,12-14H,2,4-5,8-11H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | LFBBQSLBWBLIEG-BFHYXJOUSA-N |
| XLogP | 0.48 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|