C16H26N4O2 — CID 133144175
(3aS,7R,7aR)-2-[(1-methylimidazol-2-yl)methyl]-7-morpholin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 133144175) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3aS,7R,7aR)-2-[(1-methylimidazol-2-yl)methyl]-7-morpholin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | (3aS,7R,7aR)-2-[(1-methylimidazol-2-yl)methyl]-7-morpholin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 133144175 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3aS,7R,7aR)-2-[(1-methylimidazol-2-yl)methyl]-7-morpholin-4-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | Cn1ccnc1CN1C[C@H]2COC[C@H](N3CCOCC3)[C@H]2C1 |
| InChI | InChI=1S/C16H26N4O2/c1-18-3-2-17-16(18)10-19-8-13-11-22-12-15(14(13)9-19)20-4-6-21-7-5-20/h2-3,13-15H,4-12H2,1H3/t13-,14-,15-/m0/s1 |
| InChIKey | GYXDTULPKJLRKG-KKUMJFAQSA-N |
| XLogP | 0.20 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |