About bromozinc(1+);difluoromethylbenzene
bromozinc(1+);difluoromethylbenzene (PubChem CID 133144668) has the molecular formula C7H5BrF2Zn
and a molecular weight of 272.41 g/mol. Its IUPAC name is bromozinc(1+);difluoromethylbenzene.
Molecular Properties
| Compound Name | bromozinc(1+);difluoromethylbenzene |
| PubChem CID | 133144668 |
| Molecular Formula | C7H5BrF2Zn |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 269.88 |
| IUPAC Name | bromozinc(1+);difluoromethylbenzene |
| SMILES | FC(F)c1cc[c-]cc1.[Zn+]Br |
| InChI | InChI=1S/C7H5F2.BrH.Zn/c8-7(9)6-4-2-1-3-5-6;;/h2-5,7H;1H;/q-1;;+2/p-1 |
| InChIKey | WZNKBKZMLJSVII-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);difluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);difluoromethylbenzene?
The IUPAC name of bromozinc(1+);difluoromethylbenzene (CID 133144668) is bromozinc(1+);difluoromethylbenzene.
What is the SMILES notation for bromozinc(1+);difluoromethylbenzene?
The canonical SMILES for bromozinc(1+);difluoromethylbenzene is FC(F)c1cc[c-]cc1.[Zn+]Br.
What is the InChIKey of bromozinc(1+);difluoromethylbenzene?
The InChIKey is WZNKBKZMLJSVII-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5F2.BrH.Zn/c8-7(9)6-4-2-1-3-5-6;;/h2-5,7H;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);difluoromethylbenzene?
bromozinc(1+);difluoromethylbenzene has a molecular weight of 272.41 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);difluoromethylbenzene is sourced from PubChem (CID 133144668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).