C13H18N2O3 — CID 133145120
[(3S,3aS,6aR)-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 133145120) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(3S,3aS,6aR)-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 133145120 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [(3S,3aS,6aR)-3-ethoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CCO[C@@H]1CN(C(=O)c2ccc[nH]2)[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C13H18N2O3/c1-2-18-12-6-15(11-8-17-7-9(11)12)13(16)10-4-3-5-14-10/h3-5,9,11-12,14H,2,6-8H2,1H3/t9-,11+,12-/m1/s1 |
| InChIKey | MMDNGPAFHISFHS-ADEWGFFLSA-N |
| XLogP | 0.89 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |