C21H25N3O5S — CID 133145374
4-(N-methylsulfonyl-3-nitroanilino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide (PubChem CID 133145374) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 4-(N-methylsulfonyl-3-nitroanilino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide.
| Compound Name | 4-(N-methylsulfonyl-3-nitroanilino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide |
|---|---|
| PubChem CID | 133145374 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 4-(N-methylsulfonyl-3-nitroanilino)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)butanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NC1CCCc2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N3O5S/c1-30(28,29)23(17-9-5-10-18(15-17)24(26)27)14-6-13-21(25)22-20-12-4-8-16-7-2-3-11-19(16)20/h2-3,5,7,9-11,15,20H,4,6,8,12-14H2,1H3,(H,22,25) |
| InChIKey | BBENDTICDCPWEI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|