C18H23N3O2 — CID 13314814
3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethoxy]phenyl]-1,1-dimethylurea (PubChem CID 13314814) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethoxy]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethoxy]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 13314814 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-[4-[2-(4,6-dimethyl-2-pyridinyl)ethoxy]phenyl]-1,1-dimethylurea |
| SMILES | Cc1cc(C)nc(CCOc2ccc(NC(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-11-14(2)19-16(12-13)9-10-23-17-7-5-15(6-8-17)20-18(22)21(3)4/h5-8,11-12H,9-10H2,1-4H3,(H,20,22) |
| InChIKey | XOHOOUSUGJANDS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |